Inorganic Salts
Filtered Search Results
Potassium permanganate, ACS, 99.0% min
CAS: 7722-64-7 Molecular Formula: KMnO4 Molecular Weight (g/mol): 158.032 MDL Number: MFCD00011364 InChI Key: VZJVWSHVAAUDKD-UHFFFAOYSA-N Synonym: potassium permanganate,chameleon mineral,condy's crystals,argucide,cairox,permanganate of potash,insta-perm,walko tablets,algae-k,solo san soo PubChem CID: 516875 IUPAC Name: potassium;permanganate SMILES: [O-][Mn](=O)(=O)=O.[K+]
| PubChem CID | 516875 |
|---|---|
| CAS | 7722-64-7 |
| Molecular Weight (g/mol) | 158.032 |
| MDL Number | MFCD00011364 |
| SMILES | [O-][Mn](=O)(=O)=O.[K+] |
| Synonym | potassium permanganate,chameleon mineral,condy's crystals,argucide,cairox,permanganate of potash,insta-perm,walko tablets,algae-k,solo san soo |
| IUPAC Name | potassium;permanganate |
| InChI Key | VZJVWSHVAAUDKD-UHFFFAOYSA-N |
| Molecular Formula | KMnO4 |
Magnesium chloride, 1M aq. soln., sterile-filtered
CAS: 7786-30-3 Molecular Formula: Cl2Mg Molecular Weight (g/mol): 95.21 MDL Number: MFCD00011106 InChI Key: TWRXJAOTZQYOKJ-UHFFFAOYSA-L Synonym: magnesium chloride,magnesium chloride anhydrous,mgcl2,magnesium chloride, anhydrous,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride PubChem CID: 5360315 ChEBI: CHEBI:6636 SMILES: [Mg++].[Cl-].[Cl-]
| PubChem CID | 5360315 |
|---|---|
| CAS | 7786-30-3 |
| Molecular Weight (g/mol) | 95.21 |
| ChEBI | CHEBI:6636 |
| MDL Number | MFCD00011106 |
| SMILES | [Mg++].[Cl-].[Cl-] |
| Synonym | magnesium chloride,magnesium chloride anhydrous,mgcl2,magnesium chloride, anhydrous,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride |
| InChI Key | TWRXJAOTZQYOKJ-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mg |
Sand, washed
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Silver nitrate, ACS, 99.9+% (metals basis)
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Sodium L-lactate, 98+%
CAS: 867-56-1 Molecular Formula: C3H5NaO3 MDL Number: MFCD00066576 Synonym: sodium l-lactate,sodium-l-lactate,sodium lactate, l,sodium s-2-hydroxypropanoate,unii-p2y1c6m9ps,sodium s-lactate,sodium l-+-lactate,p2y1c6m9ps,propanoic acid, 2-hydroxy-, monosodium salt, 2s,l-+-lactic acid sodium salt
| CAS | 867-56-1 |
|---|---|
| MDL Number | MFCD00066576 |
| Synonym | sodium l-lactate,sodium-l-lactate,sodium lactate, l,sodium s-2-hydroxypropanoate,unii-p2y1c6m9ps,sodium s-lactate,sodium l-+-lactate,p2y1c6m9ps,propanoic acid, 2-hydroxy-, monosodium salt, 2s,l-+-lactic acid sodium salt |
| Molecular Formula | C3H5NaO3 |
Sodium sulfide, anhydrous, Thermo Scientific Chemicals
CAS: 1313-82-2 Molecular Formula: Na2S Molecular Weight (g/mol): 78.04 MDL Number: MFCD00003498 InChI Key: GRVFOGOEDUUMBP-UHFFFAOYSA-N Synonym: sodium sulfide,sodium sulfide na2s,disodium monosulfide,na2s,disodium sulphide,sodium sulfide van,hsdb 772,sodium sulfide, anhydrous dot,sodum sulfuret,na2-s PubChem CID: 237873 SMILES: [Na+].[Na+].[S--]
| PubChem CID | 237873 |
|---|---|
| CAS | 1313-82-2 |
| Molecular Weight (g/mol) | 78.04 |
| MDL Number | MFCD00003498 |
| SMILES | [Na+].[Na+].[S--] |
| Synonym | sodium sulfide,sodium sulfide na2s,disodium monosulfide,na2s,disodium sulphide,sodium sulfide van,hsdb 772,sodium sulfide, anhydrous dot,sodum sulfuret,na2-s |
| InChI Key | GRVFOGOEDUUMBP-UHFFFAOYSA-N |
| Molecular Formula | Na2S |
Antimony potassium tartrate trihydrate, ACS, 99.0-103.0%
CAS: 28300-74-5 Molecular Formula: C8H4K2O12Sb2·3H2O MDL Number: MFCD00148863 Synonym: Potassium antimonyl tartrate
| CAS | 28300-74-5 |
|---|---|
| MDL Number | MFCD00148863 |
| Synonym | Potassium antimonyl tartrate |
| Molecular Formula | C8H4K2O12Sb2·3H2O |
Sodium hexametaphosphate, tech.
CAS: 10124-56-8 Molecular Formula: Na6O18P6 MDL Number: MFCD00136045 Synonym: Sodium metaphosphate
| CAS | 10124-56-8 |
|---|---|
| MDL Number | MFCD00136045 |
| Synonym | Sodium metaphosphate |
| Molecular Formula | Na6O18P6 |
Magnesium chloride, 1M aq. soln.
CAS: 7786-30-3 Molecular Formula: Cl2Mg Molecular Weight (g/mol): 95.21 MDL Number: MFCD00011106 InChI Key: TWRXJAOTZQYOKJ-UHFFFAOYSA-L Synonym: magnesium chloride,magnesium chloride anhydrous,mgcl2,magnesium chloride, anhydrous,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride PubChem CID: 5360315 ChEBI: CHEBI:6636 SMILES: [Mg++].[Cl-].[Cl-]
| PubChem CID | 5360315 |
|---|---|
| CAS | 7786-30-3 |
| Molecular Weight (g/mol) | 95.21 |
| ChEBI | CHEBI:6636 |
| MDL Number | MFCD00011106 |
| SMILES | [Mg++].[Cl-].[Cl-] |
| Synonym | magnesium chloride,magnesium chloride anhydrous,mgcl2,magnesium chloride, anhydrous,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride |
| InChI Key | TWRXJAOTZQYOKJ-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mg |
Manganese(II) sulfate monohydrate, 99%
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L Synonym: manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate PubChem CID: 177577 ChEBI: CHEBI:86364 IUPAC Name: manganese(2+);sulfate;hydrate SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| PubChem CID | 177577 |
|---|---|
| CAS | 10034-96-5 |
| Molecular Weight (g/mol) | 169.01 |
| ChEBI | CHEBI:86364 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| Synonym | manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate |
| IUPAC Name | manganese(2+);sulfate;hydrate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |
Sodium hydride, 57-63% oil dispersion
CAS: 7646-69-7 Molecular Formula: HNa Molecular Weight (g/mol): 23.998 MDL Number: MFCD00003471 InChI Key: BZKBCQXYZZXSCO-UHFFFAOYSA-N Synonym: sodium hydride,sodiumhydride,sodium hydride nah,sodium hydride oil dispersion,sodium monohydride,sodium hydride nad,sodiumhydrid,natrium hydride,sodium hydrid PubChem CID: 24758 IUPAC Name: sodium;hydride SMILES: [H-].[Na+]
| PubChem CID | 24758 |
|---|---|
| CAS | 7646-69-7 |
| Molecular Weight (g/mol) | 23.998 |
| MDL Number | MFCD00003471 |
| SMILES | [H-].[Na+] |
| Synonym | sodium hydride,sodiumhydride,sodium hydride nah,sodium hydride oil dispersion,sodium monohydride,sodium hydride nad,sodiumhydrid,natrium hydride,sodium hydrid |
| IUPAC Name | sodium;hydride |
| InChI Key | BZKBCQXYZZXSCO-UHFFFAOYSA-N |
| Molecular Formula | HNa |
1H,1H,2H,2H-Perfluorooctyltrichlorosilane, 97%
CAS: 78560-45-9 Molecular Formula: C8H4Cl3F13Si Molecular Weight (g/mol): 481.534 MDL Number: MFCD00042363 InChI Key: PISDRBMXQBSCIP-UHFFFAOYSA-N Synonym: trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,1h,1h,2h,2h-perfluorooctyltrichlorosilane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,tridecafluoro-1,1,2,2-tetrahydrooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluorooctyl silane,2-tridecafluorohexyl ethyltrichlorosilane,1h,1h,2h,2h-perfluorooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluoro-n-octyl silane,trichloro 1h,1h,2h,2h-tridecafluoro-n-octyl silane PubChem CID: 123578 IUPAC Name: trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane SMILES: C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
| PubChem CID | 123578 |
|---|---|
| CAS | 78560-45-9 |
| Molecular Weight (g/mol) | 481.534 |
| MDL Number | MFCD00042363 |
| SMILES | C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| Synonym | trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,1h,1h,2h,2h-perfluorooctyltrichlorosilane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,tridecafluoro-1,1,2,2-tetrahydrooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluorooctyl silane,2-tridecafluorohexyl ethyltrichlorosilane,1h,1h,2h,2h-perfluorooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluoro-n-octyl silane,trichloro 1h,1h,2h,2h-tridecafluoro-n-octyl silane |
| IUPAC Name | trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| InChI Key | PISDRBMXQBSCIP-UHFFFAOYSA-N |
| Molecular Formula | C8H4Cl3F13Si |
Molecular Probes™ Propidium Iodide
Propidium iodide (PI) is a popular red-fluorescent nuclear and chromosome counterstain. Since propidium iodide is not permeant to live cells, it is also commonly used to detect dead cells in a population.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
Ricca Chemical Company Sodium Borate, Decahydrate, ACS Reagent Grade, Ricca Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 1303-96-4 Molecular Weight (g/mol): 381.37 g/mol
| CAS | 1303-96-4 |
|---|---|
| Molecular Weight (g/mol) | 381.37 g/mol |
Sodium hypochlorite, 11-15% available chlorine
CAS: 7681-52-9 Molecular Formula: ClNaO MDL Number: MFCD00011120 InChI Key: SUKJFIGYRHOWBL-UHFFFAOYSA-N Synonym: sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution PubChem CID: 23665760 ChEBI: CHEBI:32146
| PubChem CID | 23665760 |
|---|---|
| CAS | 7681-52-9 |
| ChEBI | CHEBI:32146 |
| MDL Number | MFCD00011120 |
| Synonym | sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution |
| InChI Key | SUKJFIGYRHOWBL-UHFFFAOYSA-N |
| Molecular Formula | ClNaO |